C19H18Cl3N3O2 — CID 54844663
N-[2-methyl-3-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]phenyl]cyclopropanecarboxamide (PubChem CID 54844663) has the molecular formula C19H18Cl3N3O2 and a molecular weight of 426.73 g/mol. Its IUPAC name is N-[2-methyl-3-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[2-methyl-3-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 54844663 |
| Molecular Formula | C19H18Cl3N3O2 |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | N-[2-methyl-3-[[2-oxo-2-(2,4,5-trichloroanilino)ethyl]amino]phenyl]cyclopropanecarboxamide |
| SMILES | Cc1c(NCC(=O)Nc2cc(Cl)c(Cl)cc2Cl)cccc1NC(=O)C1CC1 |
| InChI | InChI=1S/C19H18Cl3N3O2/c1-10-15(3-2-4-16(10)25-19(27)11-5-6-11)23-9-18(26)24-17-8-13(21)12(20)7-14(17)22/h2-4,7-8,11,23H,5-6,9H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | BKETZLBILVJFPJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|