C23H31N3O4 — CID 54845953
3-[4-[[2-[3-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]-N,N-dimethylpropanamide (PubChem CID 54845953) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is 3-[4-[[2-[3-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]-N,N-dimethylpropanamide.
| Compound Name | 3-[4-[[2-[3-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 54845953 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 3-[4-[[2-[3-(2-ethoxyethoxy)anilino]-2-oxoethyl]amino]phenyl]-N,N-dimethylpropanamide |
| SMILES | CCOCCOc1cccc(NC(=O)CNc2ccc(CCC(=O)N(C)C)cc2)c1 |
| InChI | InChI=1S/C23H31N3O4/c1-4-29-14-15-30-21-7-5-6-20(16-21)25-22(27)17-24-19-11-8-18(9-12-19)10-13-23(28)26(2)3/h5-9,11-12,16,24H,4,10,13-15,17H2,1-3H3,(H,25,27) |
| InChIKey | XMVJXLKURWONBP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|