About 1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime
1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime (PubChem CID 5484598) has the molecular formula C8H5ClF3NO
and a molecular weight of 223.58 g/mol. Its IUPAC name is (NZ)-N-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]hydroxylamine.
Molecular Properties
| Compound Name | 1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime |
| PubChem CID | 5484598 |
| Molecular Formula | C8H5ClF3NO |
| Molecular Weight | 223.58 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | (NZ)-N-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]hydroxylamine |
| SMILES | C1=CC(=CC=C1/C(=N/O)/C(F)(F)F)Cl |
| InChI | InChI=1S/C8H5ClF3NO/c9-6-3-1-5(2-4-6)7(13-14)8(10,11)12/h1-4,14H/b13-7- |
| InChIKey | DHFHLGPVGBSNLI-QPEQYQDCSA-N |
| XLogP | 3.60 |
| TPSA | 32.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | 221 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime?
The IUPAC name of 1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime (CID 5484598) is (NZ)-N-[1-(4-chlorophenyl)-2,2,2-trifluoroethylidene]hydroxylamine.
What is the SMILES notation for 1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime?
The canonical SMILES for 1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime is C1=CC(=CC=C1/C(=N/O)/C(F)(F)F)Cl.
What is the InChIKey of 1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime?
The InChIKey is DHFHLGPVGBSNLI-QPEQYQDCSA-N. The full InChI is InChI=1S/C8H5ClF3NO/c9-6-3-1-5(2-4-6)7(13-14)8(10,11)12/h1-4,14H/b13-7-.
What are the key properties of 1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime?
1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime has a molecular weight of 223.58 g/mol, XLogP of 3.60, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-Chlorophenyl)-2,2,2-trifluoroethanoneoxime is sourced from PubChem (CID 5484598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).