C19H25NO3 — CID 54846808
2-amino-3-(2-hexoxynaphthalen-1-yl)propanoic acid (PubChem CID 54846808) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 2-amino-3-(2-hexoxynaphthalen-1-yl)propanoic acid.
| Compound Name | 2-amino-3-(2-hexoxynaphthalen-1-yl)propanoic acid |
|---|---|
| PubChem CID | 54846808 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2-amino-3-(2-hexoxynaphthalen-1-yl)propanoic acid |
| SMILES | CCCCCCOc1ccc2ccccc2c1CC(N)C(=O)O |
| InChI | InChI=1S/C19H25NO3/c1-2-3-4-7-12-23-18-11-10-14-8-5-6-9-15(14)16(18)13-17(20)19(21)22/h5-6,8-11,17H,2-4,7,12-13,20H2,1H3,(H,21,22) |
| InChIKey | DPCMHEARRURTQS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|