C21H24N2O2 — CID 54846862
N-methyl-1-[4-methyl-5-[4-(3-phenylpropoxy)phenyl]-1,2-oxazol-3-yl]methanamine (PubChem CID 54846862) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-methyl-1-[4-methyl-5-[4-(3-phenylpropoxy)phenyl]-1,2-oxazol-3-yl]methanamine.
| Compound Name | N-methyl-1-[4-methyl-5-[4-(3-phenylpropoxy)phenyl]-1,2-oxazol-3-yl]methanamine |
|---|---|
| PubChem CID | 54846862 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-methyl-1-[4-methyl-5-[4-(3-phenylpropoxy)phenyl]-1,2-oxazol-3-yl]methanamine |
| SMILES | CNCc1noc(-c2ccc(OCCCc3ccccc3)cc2)c1C |
| InChI | InChI=1S/C21H24N2O2/c1-16-20(15-22-2)23-25-21(16)18-10-12-19(13-11-18)24-14-6-9-17-7-4-3-5-8-17/h3-5,7-8,10-13,22H,6,9,14-15H2,1-2H3 |
| InChIKey | NQUBVCUTXJPGAO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|