C24H35NO3 — CID 54848693
N-[(2-hexoxy-3-methoxyphenyl)methyl]-1-(4-propan-2-yloxyphenyl)methanamine (PubChem CID 54848693) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is N-[(2-hexoxy-3-methoxyphenyl)methyl]-1-(4-propan-2-yloxyphenyl)methanamine.
| Compound Name | N-[(2-hexoxy-3-methoxyphenyl)methyl]-1-(4-propan-2-yloxyphenyl)methanamine |
|---|---|
| PubChem CID | 54848693 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | N-[(2-hexoxy-3-methoxyphenyl)methyl]-1-(4-propan-2-yloxyphenyl)methanamine |
| SMILES | CCCCCCOc1c(CNCc2ccc(OC(C)C)cc2)cccc1OC |
| InChI | InChI=1S/C24H35NO3/c1-5-6-7-8-16-27-24-21(10-9-11-23(24)26-4)18-25-17-20-12-14-22(15-13-20)28-19(2)3/h9-15,19,25H,5-8,16-18H2,1-4H3 |
| InChIKey | JPOULHPDQHATGP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|