C18H27N3O2 — CID 54848745
3-imidazol-1-yl-N-[[3-methoxy-4-(2-methylpropoxy)phenyl]methyl]propan-1-amine (PubChem CID 54848745) has the molecular formula C18H27N3O2 and a molecular weight of 317.43 g/mol. Its IUPAC name is 3-imidazol-1-yl-N-[[3-methoxy-4-(2-methylpropoxy)phenyl]methyl]propan-1-amine.
| Compound Name | 3-imidazol-1-yl-N-[[3-methoxy-4-(2-methylpropoxy)phenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 54848745 |
| Molecular Formula | C18H27N3O2 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 3-imidazol-1-yl-N-[[3-methoxy-4-(2-methylpropoxy)phenyl]methyl]propan-1-amine |
| SMILES | COc1cc(CNCCCn2ccnc2)ccc1OCC(C)C |
| InChI | InChI=1S/C18H27N3O2/c1-15(2)13-23-17-6-5-16(11-18(17)22-3)12-19-7-4-9-21-10-8-20-14-21/h5-6,8,10-11,14-15,19H,4,7,9,12-13H2,1-3H3 |
| InChIKey | LAHDMIWAJBXVDX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|