C19H27NO2 — CID 54849354
3-methoxy-N-[[2-(2-methylpropoxy)naphthalen-1-yl]methyl]propan-1-amine (PubChem CID 54849354) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 3-methoxy-N-[[2-(2-methylpropoxy)naphthalen-1-yl]methyl]propan-1-amine.
| Compound Name | 3-methoxy-N-[[2-(2-methylpropoxy)naphthalen-1-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 54849354 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 3-methoxy-N-[[2-(2-methylpropoxy)naphthalen-1-yl]methyl]propan-1-amine |
| SMILES | COCCCNCc1c(OCC(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C19H27NO2/c1-15(2)14-22-19-10-9-16-7-4-5-8-17(16)18(19)13-20-11-6-12-21-3/h4-5,7-10,15,20H,6,11-14H2,1-3H3 |
| InChIKey | NOMSFOQWSKMWKF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|