C12H14FN3 — CID 54850927
1-[3-(2-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]-N-methylmethanamine (PubChem CID 54850927) has the molecular formula C12H14FN3 and a molecular weight of 219.26 g/mol. Its IUPAC name is 1-[3-(2-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]-N-methylmethanamine.
| Compound Name | 1-[3-(2-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 54850927 |
| Molecular Formula | C12H14FN3 |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 1-[3-(2-fluorophenyl)-5-methyl-1H-pyrazol-4-yl]-N-methylmethanamine |
| SMILES | CNCc1c(-c2ccccc2F)n[nH]c1C |
| InChI | InChI=1S/C12H14FN3/c1-8-10(7-14-2)12(16-15-8)9-5-3-4-6-11(9)13/h3-6,14H,7H2,1-2H3,(H,15,16) |
| InChIKey | DYSCFNUDHJIJNF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |