C18H22N2O4 — CID 54852699
N-(4-amino-2-methoxyphenyl)-2-(2-ethoxyethoxy)benzamide (PubChem CID 54852699) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is N-(4-amino-2-methoxyphenyl)-2-(2-ethoxyethoxy)benzamide.
| Compound Name | N-(4-amino-2-methoxyphenyl)-2-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 54852699 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-(4-amino-2-methoxyphenyl)-2-(2-ethoxyethoxy)benzamide |
| SMILES | CCOCCOc1ccccc1C(=O)Nc1ccc(N)cc1OC |
| InChI | InChI=1S/C18H22N2O4/c1-3-23-10-11-24-16-7-5-4-6-14(16)18(21)20-15-9-8-13(19)12-17(15)22-2/h4-9,12H,3,10-11,19H2,1-2H3,(H,20,21) |
| InChIKey | NYYWNFHUZSGFJT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|