About 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline
3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline (PubChem CID 54853065) has the molecular formula C24H31N3O
and a molecular weight of 377.53 g/mol. Its IUPAC name is 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline.
Molecular Properties
| Compound Name | 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline |
| PubChem CID | 54853065 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline |
| SMILES | CC(C)(C)c1ccc(OCc2cc(-c3cccc(N)c3)n[nH]2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H31N3O/c1-23(2,3)17-10-11-22(20(13-17)24(4,5)6)28-15-19-14-21(27-26-19)16-8-7-9-18(25)12-16/h7-14H,15,25H2,1-6H3,(H,26,27) |
| InChIKey | ABWDZMGFVBIUGD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline?
The IUPAC name of 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline (CID 54853065) is 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline.
What is the SMILES notation for 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline?
The canonical SMILES for 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline is CC(C)(C)c1ccc(OCc2cc(-c3cccc(N)c3)n[nH]2)c(C(C)(C)C)c1.
What is the InChIKey of 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline?
The InChIKey is ABWDZMGFVBIUGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31N3O/c1-23(2,3)17-10-11-22(20(13-17)24(4,5)6)28-15-19-14-21(27-26-19)16-8-7-9-18(25)12-16/h7-14H,15,25H2,1-6H3,(H,26,27).
What are the key properties of 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline?
3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline has a molecular weight of 377.53 g/mol, XLogP of 5.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(2,4-ditert-butylphenoxy)methyl]-1H-pyrazol-3-yl]aniline is sourced from PubChem (CID 54853065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).