C20H28N4O2 — CID 54853822
2-amino-4-(3-butoxyphenyl)-N,N-diethyl-6-methylpyrimidine-5-carboxamide (PubChem CID 54853822) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-amino-4-(3-butoxyphenyl)-N,N-diethyl-6-methylpyrimidine-5-carboxamide.
| Compound Name | 2-amino-4-(3-butoxyphenyl)-N,N-diethyl-6-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 54853822 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-amino-4-(3-butoxyphenyl)-N,N-diethyl-6-methylpyrimidine-5-carboxamide |
| SMILES | CCCCOc1cccc(-c2nc(N)nc(C)c2C(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C20H28N4O2/c1-5-8-12-26-16-11-9-10-15(13-16)18-17(14(4)22-20(21)23-18)19(25)24(6-2)7-3/h9-11,13H,5-8,12H2,1-4H3,(H2,21,22,23) |
| InChIKey | RJJHCKVEZZHZPD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|