About 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide
2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide (PubChem CID 54854058) has the molecular formula C14H16N4O
and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide |
| PubChem CID | 54854058 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide |
| SMILES | CNC(=O)c1c(C)nc(N)nc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16N4O/c1-8-4-6-10(7-5-8)12-11(13(19)16-3)9(2)17-14(15)18-12/h4-7H,1-3H3,(H,16,19)(H2,15,17,18) |
| InChIKey | QKXAGEZYSSDUAH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide?
The IUPAC name of 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide (CID 54854058) is 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide.
What is the SMILES notation for 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide?
The canonical SMILES for 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide is CNC(=O)c1c(C)nc(N)nc1-c1ccc(C)cc1.
What is the InChIKey of 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide?
The InChIKey is QKXAGEZYSSDUAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O/c1-8-4-6-10(7-5-8)12-11(13(19)16-3)9(2)17-14(15)18-12/h4-7H,1-3H3,(H,16,19)(H2,15,17,18).
What are the key properties of 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide?
2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide has a molecular weight of 256.31 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,4-dimethyl-6-(4-methylphenyl)pyrimidine-5-carboxamide is sourced from PubChem (CID 54854058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).