C19H28BrN3O — CID 54856517
3-[4-[[5-bromo-2-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propanenitrile (PubChem CID 54856517) has the molecular formula C19H28BrN3O and a molecular weight of 394.36 g/mol. Its IUPAC name is 3-[4-[[5-bromo-2-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propanenitrile.
| Compound Name | 3-[4-[[5-bromo-2-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 54856517 |
| Molecular Formula | C19H28BrN3O |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-[4-[[5-bromo-2-(3-methylbutoxy)phenyl]methyl]piperazin-1-yl]propanenitrile |
| SMILES | CC(C)CCOc1ccc(Br)cc1CN1CCN(CCC#N)CC1 |
| InChI | InChI=1S/C19H28BrN3O/c1-16(2)6-13-24-19-5-4-18(20)14-17(19)15-23-11-9-22(10-12-23)8-3-7-21/h4-5,14,16H,3,6,8-13,15H2,1-2H3 |
| InChIKey | RWRMOXQROCWAJW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |