About 2-chloropyrimido[1,2-a]pyrimidin-4-one
2-chloropyrimido[1,2-a]pyrimidin-4-one (PubChem CID 54857422) has the molecular formula C7H4ClN3O
and a molecular weight of 181.58 g/mol. Its IUPAC name is 2-chloropyrimido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 2-chloropyrimido[1,2-a]pyrimidin-4-one |
| PubChem CID | 54857422 |
| Molecular Formula | C7H4ClN3O |
| Molecular Weight | 181.58 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 2-chloropyrimido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(Cl)nc2ncccn12 |
| InChI | InChI=1S/C7H4ClN3O/c8-5-4-6(12)11-3-1-2-9-7(11)10-5/h1-4H |
| InChIKey | PBVPNLCMPNDWJL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.58 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloropyrimido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloropyrimido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-chloropyrimido[1,2-a]pyrimidin-4-one (CID 54857422) is 2-chloropyrimido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-chloropyrimido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-chloropyrimido[1,2-a]pyrimidin-4-one is O=c1cc(Cl)nc2ncccn12.
What is the InChIKey of 2-chloropyrimido[1,2-a]pyrimidin-4-one?
The InChIKey is PBVPNLCMPNDWJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN3O/c8-5-4-6(12)11-3-1-2-9-7(11)10-5/h1-4H.
What are the key properties of 2-chloropyrimido[1,2-a]pyrimidin-4-one?
2-chloropyrimido[1,2-a]pyrimidin-4-one has a molecular weight of 181.58 g/mol, XLogP of 0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloropyrimido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 54857422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).