About 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline
4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline (PubChem CID 54858900) has the molecular formula C16H15BrN2O
and a molecular weight of 331.21 g/mol. Its IUPAC name is 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline.
Molecular Properties
| Compound Name | 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline |
| PubChem CID | 54858900 |
| Molecular Formula | C16H15BrN2O |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline |
| SMILES | Cc1cc2nc(Cc3ccc(N)cc3)oc2c(Br)c1C |
| InChI | InChI=1S/C16H15BrN2O/c1-9-7-13-16(15(17)10(9)2)20-14(19-13)8-11-3-5-12(18)6-4-11/h3-7H,8,18H2,1-2H3 |
| InChIKey | BWQDUDUOSJHRSI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline?
The IUPAC name of 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline (CID 54858900) is 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline.
What is the SMILES notation for 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline?
The canonical SMILES for 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline is Cc1cc2nc(Cc3ccc(N)cc3)oc2c(Br)c1C.
What is the InChIKey of 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline?
The InChIKey is BWQDUDUOSJHRSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrN2O/c1-9-7-13-16(15(17)10(9)2)20-14(19-13)8-11-3-5-12(18)6-4-11/h3-7H,8,18H2,1-2H3.
What are the key properties of 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline?
4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline has a molecular weight of 331.21 g/mol, XLogP of 4.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(7-bromo-5,6-dimethyl-1,3-benzoxazol-2-yl)methyl]aniline is sourced from PubChem (CID 54858900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).