C10H7F4N3S — CID 54860590
1-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)-1,2,4-triazole (PubChem CID 54860590) has the molecular formula C10H7F4N3S and a molecular weight of 277.25 g/mol. Its IUPAC name is 1-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)-1,2,4-triazole.
| Compound Name | 1-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 54860590 |
| Molecular Formula | C10H7F4N3S |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 1-(1,1,2,2-tetrafluoro-2-phenylsulfanylethyl)-1,2,4-triazole |
| SMILES | FC(F)(Sc1ccccc1)C(F)(F)n1cncn1 |
| InChI | InChI=1S/C10H7F4N3S/c11-9(12,17-7-15-6-16-17)10(13,14)18-8-4-2-1-3-5-8/h1-7H |
| InChIKey | OZTQMBUUERMWLK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|