3,5-dimethyl-1H-pyrazole-4-sulfonic acid

C5H8N2O3S — CID 548613

IUPAC3,5-dimethyl-1H-pyrazole-4-sulfonic acid
SMILESCc1n[nH]c(C)c1S(=O)(=O)O
InChIInChI=1S/C5H8N2O3S/c1-3-5(11(8,9)10)4(2)7-6-3/h1-2H3,(H,6,7)(H,8,9,10)
InChIKeyXWDFGELFGLFBNB-UHFFFAOYSA-N
MW176.20 g/mol
LogP0.27
Rot. Bonds1

About 3,5-dimethyl-1H-pyrazole-4-sulfonic acid

3,5-dimethyl-1H-pyrazole-4-sulfonic acid (PubChem CID 548613) has the molecular formula C5H8N2O3S and a molecular weight of 176.20 g/mol. Its IUPAC name is 3,5-dimethyl-1H-pyrazole-4-sulfonic acid.

Molecular Properties

Compound Name3,5-dimethyl-1H-pyrazole-4-sulfonic acid
PubChem CID548613
Molecular FormulaC5H8N2O3S
Molecular Weight176.20 g/mol
Exact Mass176.03
IUPAC Name3,5-dimethyl-1H-pyrazole-4-sulfonic acid
SMILESCc1n[nH]c(C)c1S(=O)(=O)O
InChIInChI=1S/C5H8N2O3S/c1-3-5(11(8,9)10)4(2)7-6-3/h1-2H3,(H,6,7)(H,8,9,10)
InChIKeyXWDFGELFGLFBNB-UHFFFAOYSA-N
XLogP0.27
TPSA83.05 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.20
LogP ≤ 50.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3,5-dimethyl-1H-pyrazole-4-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethyl-1H-pyrazole-4-sulfonic acid?
The IUPAC name of 3,5-dimethyl-1H-pyrazole-4-sulfonic acid (CID 548613) is 3,5-dimethyl-1H-pyrazole-4-sulfonic acid.
What is the SMILES notation for 3,5-dimethyl-1H-pyrazole-4-sulfonic acid?
The canonical SMILES for 3,5-dimethyl-1H-pyrazole-4-sulfonic acid is Cc1n[nH]c(C)c1S(=O)(=O)O.
What is the InChIKey of 3,5-dimethyl-1H-pyrazole-4-sulfonic acid?
The InChIKey is XWDFGELFGLFBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O3S/c1-3-5(11(8,9)10)4(2)7-6-3/h1-2H3,(H,6,7)(H,8,9,10).
What are the key properties of 3,5-dimethyl-1H-pyrazole-4-sulfonic acid?
3,5-dimethyl-1H-pyrazole-4-sulfonic acid has a molecular weight of 176.20 g/mol, XLogP of 0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1H-pyrazole-4-sulfonic acid is sourced from PubChem (CID 548613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).