About N-(dicyclopropylmethyl)-2,4,6-trimethylaniline
N-(dicyclopropylmethyl)-2,4,6-trimethylaniline (PubChem CID 54861632) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-2,4,6-trimethylaniline.
Molecular Properties
| Compound Name | N-(dicyclopropylmethyl)-2,4,6-trimethylaniline |
| PubChem CID | 54861632 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | N-(dicyclopropylmethyl)-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(NC(C2CC2)C2CC2)c(C)c1 |
| InChI | InChI=1S/C16H23N/c1-10-8-11(2)15(12(3)9-10)17-16(13-4-5-13)14-6-7-14/h8-9,13-14,16-17H,4-7H2,1-3H3 |
| InChIKey | LPLJNHWWVXBQKW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(dicyclopropylmethyl)-2,4,6-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(dicyclopropylmethyl)-2,4,6-trimethylaniline?
The IUPAC name of N-(dicyclopropylmethyl)-2,4,6-trimethylaniline (CID 54861632) is N-(dicyclopropylmethyl)-2,4,6-trimethylaniline.
What is the SMILES notation for N-(dicyclopropylmethyl)-2,4,6-trimethylaniline?
The canonical SMILES for N-(dicyclopropylmethyl)-2,4,6-trimethylaniline is Cc1cc(C)c(NC(C2CC2)C2CC2)c(C)c1.
What is the InChIKey of N-(dicyclopropylmethyl)-2,4,6-trimethylaniline?
The InChIKey is LPLJNHWWVXBQKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N/c1-10-8-11(2)15(12(3)9-10)17-16(13-4-5-13)14-6-7-14/h8-9,13-14,16-17H,4-7H2,1-3H3.
What are the key properties of N-(dicyclopropylmethyl)-2,4,6-trimethylaniline?
N-(dicyclopropylmethyl)-2,4,6-trimethylaniline has a molecular weight of 229.37 g/mol, XLogP of 4.21, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(dicyclopropylmethyl)-2,4,6-trimethylaniline is sourced from PubChem (CID 54861632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).