C12H17N3O3 — CID 54862261
methyl N-[3-(2-aminobutanoylamino)phenyl]carbamate (PubChem CID 54862261) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is methyl N-[3-(2-aminobutanoylamino)phenyl]carbamate.
| Compound Name | methyl N-[3-(2-aminobutanoylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 54862261 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | methyl N-[3-(2-aminobutanoylamino)phenyl]carbamate |
| SMILES | CCC(N)C(=O)Nc1cccc(NC(=O)OC)c1 |
| InChI | InChI=1S/C12H17N3O3/c1-3-10(13)11(16)14-8-5-4-6-9(7-8)15-12(17)18-2/h4-7,10H,3,13H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | UOFVBQVEUZMRNM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |