About 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one
5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one (PubChem CID 54864001) has the molecular formula C14H14F2N2O
and a molecular weight of 264.27 g/mol. Its IUPAC name is 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one |
| PubChem CID | 54864001 |
| Molecular Formula | C14H14F2N2O |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one |
| SMILES | CCn1cc(NCc2c(F)cccc2F)ccc1=O |
| InChI | InChI=1S/C14H14F2N2O/c1-2-18-9-10(6-7-14(18)19)17-8-11-12(15)4-3-5-13(11)16/h3-7,9,17H,2,8H2,1H3 |
| InChIKey | IHSMEPVDQBRLDZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one?
The IUPAC name of 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one (CID 54864001) is 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one.
What is the SMILES notation for 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one?
The canonical SMILES for 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one is CCn1cc(NCc2c(F)cccc2F)ccc1=O.
What is the InChIKey of 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one?
The InChIKey is IHSMEPVDQBRLDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2N2O/c1-2-18-9-10(6-7-14(18)19)17-8-11-12(15)4-3-5-13(11)16/h3-7,9,17H,2,8H2,1H3.
What are the key properties of 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one?
5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one has a molecular weight of 264.27 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,6-difluorophenyl)methylamino]-1-ethylpyridin-2-one is sourced from PubChem (CID 54864001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).