C15H20N4 — CID 54864487
N-[(2-methylpyrazol-3-yl)methyl]-3-pyrrolidin-1-ylaniline (PubChem CID 54864487) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is N-[(2-methylpyrazol-3-yl)methyl]-3-pyrrolidin-1-ylaniline.
| Compound Name | N-[(2-methylpyrazol-3-yl)methyl]-3-pyrrolidin-1-ylaniline |
|---|---|
| PubChem CID | 54864487 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | N-[(2-methylpyrazol-3-yl)methyl]-3-pyrrolidin-1-ylaniline |
| SMILES | Cn1nccc1CNc1cccc(N2CCCC2)c1 |
| InChI | InChI=1S/C15H20N4/c1-18-15(7-8-17-18)12-16-13-5-4-6-14(11-13)19-9-2-3-10-19/h4-8,11,16H,2-3,9-10,12H2,1H3 |
| InChIKey | IZFFTUDJVJRQJB-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |