About N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine
N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine (PubChem CID 54864790) has the molecular formula C11H11Cl2F2NOS
and a molecular weight of 314.18 g/mol. Its IUPAC name is N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine.
Molecular Properties
| Compound Name | N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine |
| PubChem CID | 54864790 |
| Molecular Formula | C11H11Cl2F2NOS |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine |
| SMILES | FC(F)Oc1c(Cl)cc(NC2CCSC2)cc1Cl |
| InChI | InChI=1S/C11H11Cl2F2NOS/c12-8-3-7(16-6-1-2-18-5-6)4-9(13)10(8)17-11(14)15/h3-4,6,11,16H,1-2,5H2 |
| InChIKey | BJSVNVIAOSFZCW-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine?
The IUPAC name of N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine (CID 54864790) is N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine.
What is the SMILES notation for N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine?
The canonical SMILES for N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine is FC(F)Oc1c(Cl)cc(NC2CCSC2)cc1Cl.
What is the InChIKey of N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine?
The InChIKey is BJSVNVIAOSFZCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2F2NOS/c12-8-3-7(16-6-1-2-18-5-6)4-9(13)10(8)17-11(14)15/h3-4,6,11,16H,1-2,5H2.
What are the key properties of N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine?
N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine has a molecular weight of 314.18 g/mol, XLogP of 4.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,5-dichloro-4-(difluoromethoxy)phenyl]thiolan-3-amine is sourced from PubChem (CID 54864790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).