C32H34N2O5S3 — CID 5486514
(2Z)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)penta-2,4-dienylidene]-6-methoxy-1,3-benzothiazole;4-methylbenzenesulfonate (PubChem CID 5486514) has the molecular formula C32H34N2O5S3 and a molecular weight of 622.83 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)penta-2,4-dienylidene]-6-methoxy-1,3-benzothiazole;4-methylbenzenesulfonate.
| Compound Name | (2Z)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)penta-2,4-dienylidene]-6-methoxy-1,3-benzothiazole;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 5486514 |
| Molecular Formula | C32H34N2O5S3 |
| Molecular Weight | 622.83 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | (2Z)-3-ethyl-2-[(2E,4E)-5-(3-ethyl-6-methoxy-1,3-benzothiazol-3-ium-2-yl)penta-2,4-dienylidene]-6-methoxy-1,3-benzothiazole;4-methylbenzenesulfonate |
| SMILES | CCN1/C(=C/C=C/C=C/c2sc3cc(OC)ccc3[n+]2CC)Sc2cc(OC)ccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C25H27N2O2S2.C7H8O3S/c1-5-26-20-14-12-18(28-3)16-22(20)30-24(26)10-8-7-9-11-25-27(6-2)21-15-13-19(29-4)17-23(21)31-25;1-6-2-4-7(5-3-6)11(8,9)10/h7-17H,5-6H2,1-4H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | CXFAVNYDTVGWAG-UHFFFAOYSA-M |
| XLogP | 7.17 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.83 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|