C13H14BrClN2S — CID 54865415
4-N-[(5-bromothiophen-3-yl)methyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine (PubChem CID 54865415) has the molecular formula C13H14BrClN2S and a molecular weight of 345.69 g/mol. Its IUPAC name is 4-N-[(5-bromothiophen-3-yl)methyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine.
| Compound Name | 4-N-[(5-bromothiophen-3-yl)methyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 54865415 |
| Molecular Formula | C13H14BrClN2S |
| Molecular Weight | 345.69 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 4-N-[(5-bromothiophen-3-yl)methyl]-2-chloro-1-N,1-N-dimethylbenzene-1,4-diamine |
| SMILES | CN(C)c1ccc(NCc2csc(Br)c2)cc1Cl |
| InChI | InChI=1S/C13H14BrClN2S/c1-17(2)12-4-3-10(6-11(12)15)16-7-9-5-13(14)18-8-9/h3-6,8,16H,7H2,1-2H3 |
| InChIKey | ZHCRNKRMJOREOA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.69 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|