C13H19BrN2OS — CID 54866261
2-[(5-bromothiophen-3-yl)methylamino]-1-piperidin-1-ylpropan-1-one (PubChem CID 54866261) has the molecular formula C13H19BrN2OS and a molecular weight of 331.28 g/mol. Its IUPAC name is 2-[(5-bromothiophen-3-yl)methylamino]-1-piperidin-1-ylpropan-1-one.
| Compound Name | 2-[(5-bromothiophen-3-yl)methylamino]-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 54866261 |
| Molecular Formula | C13H19BrN2OS |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-[(5-bromothiophen-3-yl)methylamino]-1-piperidin-1-ylpropan-1-one |
| SMILES | CC(NCc1csc(Br)c1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C13H19BrN2OS/c1-10(13(17)16-5-3-2-4-6-16)15-8-11-7-12(14)18-9-11/h7,9-10,15H,2-6,8H2,1H3 |
| InChIKey | WSXSRJCDYJRPGV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |