C13H15N3O3 — CID 54866853
6-(1H-indazol-4-ylamino)-6-oxohexanoic acid (PubChem CID 54866853) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 6-(1H-indazol-4-ylamino)-6-oxohexanoic acid.
| Compound Name | 6-(1H-indazol-4-ylamino)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 54866853 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 6-(1H-indazol-4-ylamino)-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)Nc1cccc2[nH]ncc12 |
| InChI | InChI=1S/C13H15N3O3/c17-12(6-1-2-7-13(18)19)15-10-4-3-5-11-9(10)8-14-16-11/h3-5,8H,1-2,6-7H2,(H,14,16)(H,15,17)(H,18,19) |
| InChIKey | GGDBYIQYQBTSHZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|