About 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one
5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one (PubChem CID 54866878) has the molecular formula C11H16N2O3S
and a molecular weight of 256.33 g/mol. Its IUPAC name is 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one |
| PubChem CID | 54866878 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one |
| SMILES | CCn1cc(NC2CCS(=O)(=O)C2)ccc1=O |
| InChI | InChI=1S/C11H16N2O3S/c1-2-13-7-9(3-4-11(13)14)12-10-5-6-17(15,16)8-10/h3-4,7,10,12H,2,5-6,8H2,1H3 |
| InChIKey | SGWZGJLLPIAJEI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one?
The IUPAC name of 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one (CID 54866878) is 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one.
What is the SMILES notation for 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one?
The canonical SMILES for 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one is CCn1cc(NC2CCS(=O)(=O)C2)ccc1=O.
What is the InChIKey of 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one?
The InChIKey is SGWZGJLLPIAJEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3S/c1-2-13-7-9(3-4-11(13)14)12-10-5-6-17(15,16)8-10/h3-4,7,10,12H,2,5-6,8H2,1H3.
What are the key properties of 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one?
5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one has a molecular weight of 256.33 g/mol, XLogP of 0.47, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,1-dioxothiolan-3-yl)amino]-1-ethylpyridin-2-one is sourced from PubChem (CID 54866878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).