C13H16FNO3 — CID 54867216
N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-3-oxobutanamide (PubChem CID 54867216) has the molecular formula C13H16FNO3 and a molecular weight of 253.27 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-3-oxobutanamide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-3-oxobutanamide |
|---|---|
| PubChem CID | 54867216 |
| Molecular Formula | C13H16FNO3 |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-3-oxobutanamide |
| SMILES | COc1ccc(CN(C)C(=O)CC(C)=O)cc1F |
| InChI | InChI=1S/C13H16FNO3/c1-9(16)6-13(17)15(2)8-10-4-5-12(18-3)11(14)7-10/h4-5,7H,6,8H2,1-3H3 |
| InChIKey | SHSGPAXFCIRLBZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|