C11H16N2O4 — CID 54867615
(E)-4-oxo-4-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]but-2-enoic acid (PubChem CID 54867615) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (E)-4-oxo-4-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 54867615 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (E)-4-oxo-4-[(3-oxo-3-pyrrolidin-1-ylpropyl)amino]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)NCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C11H16N2O4/c14-9(3-4-11(16)17)12-6-5-10(15)13-7-1-2-8-13/h3-4H,1-2,5-8H2,(H,12,14)(H,16,17)/b4-3+ |
| InChIKey | KNTSEUWWKDWWCU-ONEGZZNKSA-N |
| XLogP | -0.24 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|