C13H14N2O2S — CID 54868801
N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 54868801) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 54868801 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | Cc1ncc(CNc2ccc3c(c2)OCCO3)s1 |
| InChI | InChI=1S/C13H14N2O2S/c1-9-14-7-11(18-9)8-15-10-2-3-12-13(6-10)17-5-4-16-12/h2-3,6-7,15H,4-5,8H2,1H3 |
| InChIKey | ARHPRAFFSORZQW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|