C14H20ClFN2O — CID 54869007
6-amino-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylhexanamide (PubChem CID 54869007) has the molecular formula C14H20ClFN2O and a molecular weight of 286.78 g/mol. Its IUPAC name is 6-amino-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylhexanamide.
| Compound Name | 6-amino-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylhexanamide |
|---|---|
| PubChem CID | 54869007 |
| Molecular Formula | C14H20ClFN2O |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 6-amino-N-[(2-chloro-6-fluorophenyl)methyl]-N-methylhexanamide |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)CCCCCN |
| InChI | InChI=1S/C14H20ClFN2O/c1-18(14(19)8-3-2-4-9-17)10-11-12(15)6-5-7-13(11)16/h5-7H,2-4,8-10,17H2,1H3 |
| InChIKey | CMCBJXGRNICGRG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|