C15H25N3O — CID 54869090
6-amino-1-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexan-1-one (PubChem CID 54869090) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 6-amino-1-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexan-1-one.
| Compound Name | 6-amino-1-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexan-1-one |
|---|---|
| PubChem CID | 54869090 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 6-amino-1-(1,6-dimethyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexan-1-one |
| SMILES | Cc1ccc2n1CCN(C(=O)CCCCCN)C2C |
| InChI | InChI=1S/C15H25N3O/c1-12-7-8-14-13(2)18(11-10-17(12)14)15(19)6-4-3-5-9-16/h7-8,13H,3-6,9-11,16H2,1-2H3 |
| InChIKey | JHQGDPOXJRVRCP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|