C9H9FN4O5 — CID 5486955
(2S)-2-(5-fluoro-2,4-dinitroanilino)propanamide (PubChem CID 5486955) has the molecular formula C9H9FN4O5 and a molecular weight of 272.19 g/mol. Its IUPAC name is (2S)-2-(5-fluoro-2,4-dinitroanilino)propanamide.
| Compound Name | (2S)-2-(5-fluoro-2,4-dinitroanilino)propanamide |
|---|---|
| PubChem CID | 5486955 |
| Molecular Formula | C9H9FN4O5 |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (2S)-2-(5-fluoro-2,4-dinitroanilino)propanamide |
| SMILES | C[C@H](Nc1cc(F)c([N+](=O)[O-])cc1[N+](=O)[O-])C(N)=O |
| InChI | InChI=1S/C9H9FN4O5/c1-4(9(11)15)12-6-2-5(10)7(13(16)17)3-8(6)14(18)19/h2-4,12H,1H3,(H2,11,15)/t4-/m0/s1 |
| InChIKey | NEPLBHLFDJOJGP-BYPYZUCNSA-N |
| XLogP | 0.93 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|