C11H19F3N2O2S — CID 54871732
N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 54871732) has the molecular formula C11H19F3N2O2S and a molecular weight of 300.35 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 54871732 |
| Molecular Formula | C11H19F3N2O2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(3-ethoxypropyl)-N-(2,2,2-trifluoroethyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCOCCCN(CC(F)(F)F)C(=O)C1CSCN1 |
| InChI | InChI=1S/C11H19F3N2O2S/c1-2-18-5-3-4-16(7-11(12,13)14)10(17)9-6-19-8-15-9/h9,15H,2-8H2,1H3 |
| InChIKey | MBDRNQURERQHLZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|