C14H26N2O3 — CID 54872362
methyl 3-[(2-amino-2-cyclopropylpropanoyl)-(2-methylpropyl)amino]propanoate (PubChem CID 54872362) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl 3-[(2-amino-2-cyclopropylpropanoyl)-(2-methylpropyl)amino]propanoate.
| Compound Name | methyl 3-[(2-amino-2-cyclopropylpropanoyl)-(2-methylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 54872362 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | methyl 3-[(2-amino-2-cyclopropylpropanoyl)-(2-methylpropyl)amino]propanoate |
| SMILES | COC(=O)CCN(CC(C)C)C(=O)C(C)(N)C1CC1 |
| InChI | InChI=1S/C14H26N2O3/c1-10(2)9-16(8-7-12(17)19-4)13(18)14(3,15)11-5-6-11/h10-11H,5-9,15H2,1-4H3 |
| InChIKey | PJOHLAGLYCEMIL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |