C14H20Cl2N2O — CID 54872621
2-amino-N-[(3,5-dichlorophenyl)methyl]-N,2-dimethylpentanamide (PubChem CID 54872621) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is 2-amino-N-[(3,5-dichlorophenyl)methyl]-N,2-dimethylpentanamide.
| Compound Name | 2-amino-N-[(3,5-dichlorophenyl)methyl]-N,2-dimethylpentanamide |
|---|---|
| PubChem CID | 54872621 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2-amino-N-[(3,5-dichlorophenyl)methyl]-N,2-dimethylpentanamide |
| SMILES | CCCC(C)(N)C(=O)N(C)Cc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-4-5-14(2,17)13(19)18(3)9-10-6-11(15)8-12(16)7-10/h6-8H,4-5,9,17H2,1-3H3 |
| InChIKey | IJEQZGBOORFJAF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |