C12H11N3O — CID 5487281
7,8-dimethyl-1,3-dihydroimidazo[4,5-b]quinolin-2-one (PubChem CID 5487281) has the molecular formula C12H11N3O and a molecular weight of 213.24 g/mol. Its IUPAC name is 7,8-dimethyl-1,3-dihydroimidazo[4,5-b]quinolin-2-one.
| Compound Name | 7,8-dimethyl-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
|---|---|
| PubChem CID | 5487281 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 7,8-dimethyl-1,3-dihydroimidazo[4,5-b]quinolin-2-one |
| SMILES | Cc1ccc2nc3[nH]c(=O)[nH]c3cc2c1C |
| InChI | InChI=1S/C12H11N3O/c1-6-3-4-9-8(7(6)2)5-10-11(13-9)15-12(16)14-10/h3-5H,1-2H3,(H2,13,14,15,16) |
| InChIKey | ODCKPUDNMNCWMR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |