C13H14FNO3 — CID 54874794
(E)-4-[ethyl-[(3-fluorophenyl)methyl]amino]-4-oxobut-2-enoic acid (PubChem CID 54874794) has the molecular formula C13H14FNO3 and a molecular weight of 251.26 g/mol. Its IUPAC name is (E)-4-[ethyl-[(3-fluorophenyl)methyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[ethyl-[(3-fluorophenyl)methyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54874794 |
| Molecular Formula | C13H14FNO3 |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (E)-4-[ethyl-[(3-fluorophenyl)methyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H14FNO3/c1-2-15(12(16)6-7-13(17)18)9-10-4-3-5-11(14)8-10/h3-8H,2,9H2,1H3,(H,17,18)/b7-6+ |
| InChIKey | PIBFCKFGRAOPEK-VOTSOKGWSA-N |
| XLogP | 1.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|