C12H20ClN3O2 — CID 54875154
2-[4-(3-chloropropanoyl)piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 54875154) has the molecular formula C12H20ClN3O2 and a molecular weight of 273.76 g/mol. Its IUPAC name is 2-[4-(3-chloropropanoyl)piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-(3-chloropropanoyl)piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 54875154 |
| Molecular Formula | C12H20ClN3O2 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-[4-(3-chloropropanoyl)piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(C(=O)CCCl)CC1 |
| InChI | InChI=1S/C12H20ClN3O2/c1-2-5-14-11(17)10-15-6-8-16(9-7-15)12(18)3-4-13/h2H,1,3-10H2,(H,14,17) |
| InChIKey | JTWILIADKMJHLQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|