About pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol
pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol (PubChem CID 548752) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol.
Molecular Properties
| Compound Name | pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol |
| PubChem CID | 548752 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol |
| SMILES | OC1C2C3CC4C2C2C1C3C42 |
| InChI | InChI=1S/C10H12O/c11-10-7-3-1-2-4-5(3)9(10)8(4)6(2)7/h2-11H,1H2 |
| InChIKey | KSRRHRNTPWNNTN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol?
The IUPAC name of pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol (CID 548752) is pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol.
What is the SMILES notation for pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol?
The canonical SMILES for pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol is OC1C2C3CC4C2C2C1C3C42.
What is the InChIKey of pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol?
The InChIKey is KSRRHRNTPWNNTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c11-10-7-3-1-2-4-5(3)9(10)8(4)6(2)7/h2-11H,1H2.
What are the key properties of pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol?
pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol has a molecular weight of 148.20 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentacyclo[5.3.0.02,5.03,9.04,8]decan-6-ol is sourced from PubChem (CID 548752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).