C12H17NO4 — CID 54875351
(E)-4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-4-oxobut-2-enoic acid (PubChem CID 54875351) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is (E)-4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 54875351 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | (E)-4-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C12H17NO4/c14-11(5-6-12(15)16)13-7-8-17-10-4-2-1-3-9(10)13/h5-6,9-10H,1-4,7-8H2,(H,15,16)/b6-5+ |
| InChIKey | FONDGOKJWCUYFF-AATRIKPKSA-N |
| XLogP | 0.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|