About (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid
(E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid (PubChem CID 54875529) has the molecular formula C10H14F3NO3
and a molecular weight of 253.22 g/mol. Its IUPAC name is (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid.
Molecular Properties
| Compound Name | (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid |
| PubChem CID | 54875529 |
| Molecular Formula | C10H14F3NO3 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid |
| SMILES | CCCCN(CC(F)(F)F)C(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C10H14F3NO3/c1-2-3-6-14(7-10(11,12)13)8(15)4-5-9(16)17/h4-5H,2-3,6-7H2,1H3,(H,16,17)/b5-4+ |
| InChIKey | LTCUNRLSZAUIKS-SNAWJCMRSA-N |
| XLogP | 1.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid?
The IUPAC name of (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid (CID 54875529) is (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid.
What is the SMILES notation for (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid?
The canonical SMILES for (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid is CCCCN(CC(F)(F)F)C(=O)/C=C/C(=O)O.
What is the InChIKey of (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid?
The InChIKey is LTCUNRLSZAUIKS-SNAWJCMRSA-N. The full InChI is InChI=1S/C10H14F3NO3/c1-2-3-6-14(7-10(11,12)13)8(15)4-5-9(16)17/h4-5H,2-3,6-7H2,1H3,(H,16,17)/b5-4+.
What are the key properties of (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid?
(E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid has a molecular weight of 253.22 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[butyl(2,2,2-trifluoroethyl)amino]-4-oxobut-2-enoic acid is sourced from PubChem (CID 54875529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).