C13H17NO3 — CID 54875824
N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 54875824) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 54875824 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(2-hydroxyethyl)-N-[(2-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCO)Cc1ccccc1OC |
| InChI | InChI=1S/C13H17NO3/c1-3-13(16)14(8-9-15)10-11-6-4-5-7-12(11)17-2/h3-7,15H,1,8-10H2,2H3 |
| InChIKey | ZVELCADZRYLLFP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|