C15H22BrNO2 — CID 54876015
2-bromo-N-[(2-ethoxyphenyl)methyl]-N,3-dimethylbutanamide (PubChem CID 54876015) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is 2-bromo-N-[(2-ethoxyphenyl)methyl]-N,3-dimethylbutanamide.
| Compound Name | 2-bromo-N-[(2-ethoxyphenyl)methyl]-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 54876015 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-bromo-N-[(2-ethoxyphenyl)methyl]-N,3-dimethylbutanamide |
| SMILES | CCOc1ccccc1CN(C)C(=O)C(Br)C(C)C |
| InChI | InChI=1S/C15H22BrNO2/c1-5-19-13-9-7-6-8-12(13)10-17(4)15(18)14(16)11(2)3/h6-9,11,14H,5,10H2,1-4H3 |
| InChIKey | MNIUNAADFXTEJE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|