C12H23NO5S — CID 54876206
4-[cyclohexyl(2-hydroxyethyl)sulfamoyl]butanoic acid (PubChem CID 54876206) has the molecular formula C12H23NO5S and a molecular weight of 293.38 g/mol. Its IUPAC name is 4-[cyclohexyl(2-hydroxyethyl)sulfamoyl]butanoic acid.
| Compound Name | 4-[cyclohexyl(2-hydroxyethyl)sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 54876206 |
| Molecular Formula | C12H23NO5S |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 4-[cyclohexyl(2-hydroxyethyl)sulfamoyl]butanoic acid |
| SMILES | O=C(O)CCCS(=O)(=O)N(CCO)C1CCCCC1 |
| InChI | InChI=1S/C12H23NO5S/c14-9-8-13(11-5-2-1-3-6-11)19(17,18)10-4-7-12(15)16/h11,14H,1-10H2,(H,15,16) |
| InChIKey | CSTIEEUPRHMTAX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |