4-[butan-2-yl(butyl)sulfamoyl]butanoic acid

C12H25NO4S — CID 54876216

IUPAC4-[butan-2-yl(butyl)sulfamoyl]butanoic acid
SMILESCCCCN(C(C)CC)S(=O)(=O)CCCC(=O)O
InChIInChI=1S/C12H25NO4S/c1-4-6-9-13(11(3)5-2)18(16,17)10-7-8-12(14)15/h11H,4-10H2,1-3H3,(H,14,15)
InChIKeyHNMZACYSYCGKEW-UHFFFAOYSA-N
MW279.40 g/mol
LogP2.08
Rot. Bonds10

About 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid

4-[butan-2-yl(butyl)sulfamoyl]butanoic acid (PubChem CID 54876216) has the molecular formula C12H25NO4S and a molecular weight of 279.40 g/mol. Its IUPAC name is 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid.

Molecular Properties

Compound Name4-[butan-2-yl(butyl)sulfamoyl]butanoic acid
PubChem CID54876216
Molecular FormulaC12H25NO4S
Molecular Weight279.40 g/mol
Exact Mass279.15
IUPAC Name4-[butan-2-yl(butyl)sulfamoyl]butanoic acid
SMILESCCCCN(C(C)CC)S(=O)(=O)CCCC(=O)O
InChIInChI=1S/C12H25NO4S/c1-4-6-9-13(11(3)5-2)18(16,17)10-7-8-12(14)15/h11H,4-10H2,1-3H3,(H,14,15)
InChIKeyHNMZACYSYCGKEW-UHFFFAOYSA-N
XLogP2.08
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds10
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.40
LogP ≤ 52.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-(Pyrrolidine-1-sulfonyl)butanoic acid
CID 28513434
4-[Butyl(2,2,2-trifluoroethyl)sulfamoyl]butanoic acid
CID 54876241
4-[Propan-2-yl(2,2,2-trifluoroethyl)sulfamoyl]butanoic acid
CID 54876267
2-[Butyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid
CID 54947756
3-[Butyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid
CID 60951576
4-[Propyl(2,2,2-trifluoroethyl)sulfamoyl]butanoic acid
CID 60952152
4-[Pentan-3-yl(2,2,2-trifluoroethyl)sulfamoyl]butanoic acid
CID 60952310
3-[Pentan-3-yl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid
CID 60952311
2-[Pentan-3-yl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid
CID 61457946
4-[Propan-2-yl(4,4,4-trifluorobutylsulfonyl)amino]butanoic acid
CID 83067801
3-[Ethyl(4,4,4-trifluorobutylsulfonyl)amino]butanoic acid
CID 83068328
2-[Di(butan-2-yl)sulfamoyl]acetic acid
CID 18988670

Frequently Asked Questions

What is the IUPAC name of 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid?
The IUPAC name of 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid (CID 54876216) is 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid.
What is the SMILES notation for 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid?
The canonical SMILES for 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid is CCCCN(C(C)CC)S(=O)(=O)CCCC(=O)O.
What is the InChIKey of 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid?
The InChIKey is HNMZACYSYCGKEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO4S/c1-4-6-9-13(11(3)5-2)18(16,17)10-7-8-12(14)15/h11H,4-10H2,1-3H3,(H,14,15).
What are the key properties of 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid?
4-[butan-2-yl(butyl)sulfamoyl]butanoic acid has a molecular weight of 279.40 g/mol, XLogP of 2.08, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[butan-2-yl(butyl)sulfamoyl]butanoic acid is sourced from PubChem (CID 54876216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).