About 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one
3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one (PubChem CID 5487671) has the molecular formula C16H10O6
and a molecular weight of 298.25 g/mol. Its IUPAC name is 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one.
Molecular Properties
| Compound Name | 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one |
| PubChem CID | 5487671 |
| Molecular Formula | C16H10O6 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one |
| SMILES | COc1cc(O)c2c(c1)oc1c3ccc(O)cc3oc(=O)c12 |
| InChI | InChI=1S/C16H10O6/c1-20-8-5-10(18)13-12(6-8)21-15-9-3-2-7(17)4-11(9)22-16(19)14(13)15/h2-6,17-18H,1H3 |
| InChIKey | YFVNQUXNYCREJW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one?
The IUPAC name of 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one (CID 5487671) is 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one.
What is the SMILES notation for 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one?
The canonical SMILES for 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one is COc1cc(O)c2c(c1)oc1c3ccc(O)cc3oc(=O)c12.
What is the InChIKey of 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one?
The InChIKey is YFVNQUXNYCREJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O6/c1-20-8-5-10(18)13-12(6-8)21-15-9-3-2-7(17)4-11(9)22-16(19)14(13)15/h2-6,17-18H,1H3.
What are the key properties of 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one?
3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one has a molecular weight of 298.25 g/mol, XLogP of 3.11, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dihydroxy-9-methoxy-[1]benzofuro[3,2-c]chromen-6-one is sourced from PubChem (CID 5487671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).