C12H18N2O3 — CID 54876750
1-[4-(cyclopropanecarbonyl)piperazin-1-yl]butane-1,3-dione (PubChem CID 54876750) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-[4-(cyclopropanecarbonyl)piperazin-1-yl]butane-1,3-dione.
| Compound Name | 1-[4-(cyclopropanecarbonyl)piperazin-1-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 54876750 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 1-[4-(cyclopropanecarbonyl)piperazin-1-yl]butane-1,3-dione |
| SMILES | CC(=O)CC(=O)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C12H18N2O3/c1-9(15)8-11(16)13-4-6-14(7-5-13)12(17)10-2-3-10/h10H,2-8H2,1H3 |
| InChIKey | MYKXOJHXXGSURW-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|