C9H16ClF3N2O3S — CID 54877257
2-[3-chloropropylsulfonyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide (PubChem CID 54877257) has the molecular formula C9H16ClF3N2O3S and a molecular weight of 324.75 g/mol. Its IUPAC name is 2-[3-chloropropylsulfonyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide.
| Compound Name | 2-[3-chloropropylsulfonyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 54877257 |
| Molecular Formula | C9H16ClF3N2O3S |
| Molecular Weight | 324.75 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 2-[3-chloropropylsulfonyl(2,2,2-trifluoroethyl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN(CC(F)(F)F)S(=O)(=O)CCCCl |
| InChI | InChI=1S/C9H16ClF3N2O3S/c1-14(2)8(16)6-15(7-9(11,12)13)19(17,18)5-3-4-10/h3-7H2,1-2H3 |
| InChIKey | UFOPMAORCWVLCR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.75 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|